C19H12N2O6 — CID 1274423
[2-[(1,3-dioxoisoindol-2-yl)methyl]-4-oxo-3,1-benzoxazin-6-yl] acetate (PubChem CID 1274423) has the molecular formula C19H12N2O6 and a molecular weight of 364.31 g/mol. Its IUPAC name is [2-[(1,3-dioxoisoindol-2-yl)methyl]-4-oxo-3,1-benzoxazin-6-yl] acetate.
| Compound Name | [2-[(1,3-dioxoisoindol-2-yl)methyl]-4-oxo-3,1-benzoxazin-6-yl] acetate |
|---|---|
| PubChem CID | 1274423 |
| Molecular Formula | C19H12N2O6 |
| Molecular Weight | 364.31 g/mol |
| Exact Mass | 364.07 |
| IUPAC Name | [2-[(1,3-dioxoisoindol-2-yl)methyl]-4-oxo-3,1-benzoxazin-6-yl] acetate |
| SMILES | CC(=O)Oc1ccc2nc(CN3C(=O)c4ccccc4C3=O)oc(=O)c2c1 |
| InChI | InChI=1S/C19H12N2O6/c1-10(22)26-11-6-7-15-14(8-11)19(25)27-16(20-15)9-21-17(23)12-4-2-3-5-13(12)18(21)24/h2-8H,9H2,1H3 |
| InChIKey | AVTIWSGCCJLRJS-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 106.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.31 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|