C17H12N2O6 — CID 752378
[2-(2-methyl-3-nitrophenyl)-4-oxo-3,1-benzoxazin-6-yl] acetate (PubChem CID 752378) has the molecular formula C17H12N2O6 and a molecular weight of 340.29 g/mol. Its IUPAC name is [2-(2-methyl-3-nitrophenyl)-4-oxo-3,1-benzoxazin-6-yl] acetate.
| Compound Name | [2-(2-methyl-3-nitrophenyl)-4-oxo-3,1-benzoxazin-6-yl] acetate |
|---|---|
| PubChem CID | 752378 |
| Molecular Formula | C17H12N2O6 |
| Molecular Weight | 340.29 g/mol |
| Exact Mass | 340.07 |
| IUPAC Name | [2-(2-methyl-3-nitrophenyl)-4-oxo-3,1-benzoxazin-6-yl] acetate |
| SMILES | CC(=O)Oc1ccc2nc(-c3cccc([N+](=O)[O-])c3C)oc(=O)c2c1 |
| InChI | InChI=1S/C17H12N2O6/c1-9-12(4-3-5-15(9)19(22)23)16-18-14-7-6-11(24-10(2)20)8-13(14)17(21)25-16/h3-8H,1-2H3 |
| InChIKey | QLFGUZYENLIHIC-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 112.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.29 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|