C17H13NO4 — CID 789612
(2-benzyl-4-oxo-3,1-benzoxazin-6-yl) acetate (PubChem CID 789612) has the molecular formula C17H13NO4 and a molecular weight of 295.29 g/mol. Its IUPAC name is (2-benzyl-4-oxo-3,1-benzoxazin-6-yl) acetate.
| Compound Name | (2-benzyl-4-oxo-3,1-benzoxazin-6-yl) acetate |
|---|---|
| PubChem CID | 789612 |
| Molecular Formula | C17H13NO4 |
| Molecular Weight | 295.29 g/mol |
| Exact Mass | 295.08 |
| IUPAC Name | (2-benzyl-4-oxo-3,1-benzoxazin-6-yl) acetate |
| SMILES | CC(=O)Oc1ccc2nc(Cc3ccccc3)oc(=O)c2c1 |
| InChI | InChI=1S/C17H13NO4/c1-11(19)21-13-7-8-15-14(10-13)17(20)22-16(18-15)9-12-5-3-2-4-6-12/h2-8,10H,9H2,1H3 |
| InChIKey | IVRVIBVIOFFEMD-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 69.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.29 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|