(2,4-dichloroquinazolin-6-yl) acetate

C10H6Cl2N2O2 — CID 101166088

IUPAC(2,4-dichloroquinazolin-6-yl) acetate
SMILESCC(=O)Oc1ccc2nc(Cl)nc(Cl)c2c1
InChIInChI=1S/C10H6Cl2N2O2/c1-5(15)16-6-2-3-8-7(4-6)9(11)14-10(12)13-8/h2-4H,1H3
InChIKeyFSLXUENCQLTFTM-UHFFFAOYSA-N
MW257.08 g/mol
LogP2.86
Rot. Bonds1

About (2,4-dichloroquinazolin-6-yl) acetate

(2,4-dichloroquinazolin-6-yl) acetate (PubChem CID 101166088) has the molecular formula C10H6Cl2N2O2 and a molecular weight of 257.08 g/mol. Its IUPAC name is (2,4-dichloroquinazolin-6-yl) acetate.

Molecular Properties

Compound Name(2,4-dichloroquinazolin-6-yl) acetate
PubChem CID101166088
Molecular FormulaC10H6Cl2N2O2
Molecular Weight257.08 g/mol
Exact Mass255.98
IUPAC Name(2,4-dichloroquinazolin-6-yl) acetate
SMILESCC(=O)Oc1ccc2nc(Cl)nc(Cl)c2c1
InChIInChI=1S/C10H6Cl2N2O2/c1-5(15)16-6-2-3-8-7(4-6)9(11)14-10(12)13-8/h2-4H,1H3
InChIKeyFSLXUENCQLTFTM-UHFFFAOYSA-N
XLogP2.86
TPSA52.08 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500257.08
LogP ≤ 52.86
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phenol_ester', 'substructure': 'N/A'}

Analyze (2,4-dichloroquinazolin-6-yl) acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2,4-dichloroquinazolin-6-yl) acetate?
The IUPAC name of (2,4-dichloroquinazolin-6-yl) acetate (CID 101166088) is (2,4-dichloroquinazolin-6-yl) acetate.
What is the SMILES notation for (2,4-dichloroquinazolin-6-yl) acetate?
The canonical SMILES for (2,4-dichloroquinazolin-6-yl) acetate is CC(=O)Oc1ccc2nc(Cl)nc(Cl)c2c1.
What is the InChIKey of (2,4-dichloroquinazolin-6-yl) acetate?
The InChIKey is FSLXUENCQLTFTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6Cl2N2O2/c1-5(15)16-6-2-3-8-7(4-6)9(11)14-10(12)13-8/h2-4H,1H3.
What are the key properties of (2,4-dichloroquinazolin-6-yl) acetate?
(2,4-dichloroquinazolin-6-yl) acetate has a molecular weight of 257.08 g/mol, XLogP of 2.86, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2,4-dichloroquinazolin-6-yl) acetate is sourced from PubChem (CID 101166088), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).