About CID 67900504
CID 67900504 (PubChem CID 67900504) has the molecular formula C9H7NNa2O6
and a molecular weight of 271.14 g/mol.
Molecular Properties
| Compound Name | CID 67900504 |
| PubChem CID | 67900504 |
| Molecular Formula | C9H7NNa2O6 |
| Molecular Weight | 271.14 g/mol |
| Exact Mass | 271.01 |
| IUPAC Name | — |
| SMILES | CC(=O)Oc1cc(C(=O)O)nc(C(=O)O)c1.[Na].[Na] |
| InChI | InChI=1S/C9H7NO6.2Na/c1-4(11)16-5-2-6(8(12)13)10-7(3-5)9(14)15;;/h2-3H,1H3,(H,12,13)(H,14,15);; |
| InChIKey | GOWNFOVZEZKZOM-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 113.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.14 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze CID 67900504 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 67900504?
The IUPAC name of CID 67900504 (CID 67900504) is not available.
What is the SMILES notation for CID 67900504?
The canonical SMILES for CID 67900504 is CC(=O)Oc1cc(C(=O)O)nc(C(=O)O)c1.[Na].[Na].
What is the InChIKey of CID 67900504?
The InChIKey is GOWNFOVZEZKZOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NO6.2Na/c1-4(11)16-5-2-6(8(12)13)10-7(3-5)9(14)15;;/h2-3H,1H3,(H,12,13)(H,14,15);;.
What are the key properties of CID 67900504?
CID 67900504 has a molecular weight of 271.14 g/mol, XLogP of -0.36, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 67900504 is sourced from PubChem (CID 67900504), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).