C42H48N2O8 — CID 139648449
[2-[4-(6-decanoyloxy-4-oxo-3,1-benzoxazin-2-yl)phenyl]-4-oxo-3,1-benzoxazin-6-yl] decanoate (PubChem CID 139648449) has the molecular formula C42H48N2O8 and a molecular weight of 708.85 g/mol. Its IUPAC name is [2-[4-(6-decanoyloxy-4-oxo-3,1-benzoxazin-2-yl)phenyl]-4-oxo-3,1-benzoxazin-6-yl] decanoate.
| Compound Name | [2-[4-(6-decanoyloxy-4-oxo-3,1-benzoxazin-2-yl)phenyl]-4-oxo-3,1-benzoxazin-6-yl] decanoate |
|---|---|
| PubChem CID | 139648449 |
| Molecular Formula | C42H48N2O8 |
| Molecular Weight | 708.85 g/mol |
| Exact Mass | 708.34 |
| IUPAC Name | [2-[4-(6-decanoyloxy-4-oxo-3,1-benzoxazin-2-yl)phenyl]-4-oxo-3,1-benzoxazin-6-yl] decanoate |
| SMILES | CCCCCCCCCC(=O)Oc1ccc2nc(-c3ccc(-c4nc5ccc(OC(=O)CCCCCCCCC)cc5c(=O)o4)cc3)oc(=O)c2c1 |
| InChI | InChI=1S/C42H48N2O8/c1-3-5-7-9-11-13-15-17-37(45)49-31-23-25-35-33(27-31)41(47)51-39(43-35)29-19-21-30(22-20-29)40-44-36-26-24-32(28-34(36)42(48)52-40)50-38(46)18-16-14-12-10-8-6-4-2/h19-28H,3-18H2,1-2H3 |
| InChIKey | ZPEYGJYRXNANBN-UHFFFAOYSA-N |
| XLogP | 10.12 |
| TPSA | 138.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.85 |
| LogP ≤ 5 | 10.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|