C34H32N2O8 — CID 139648468
[2-[4-(7-hexanoyloxy-4-oxo-3,1-benzoxazin-2-yl)phenyl]-4-oxo-3,1-benzoxazin-7-yl] hexanoate (PubChem CID 139648468) has the molecular formula C34H32N2O8 and a molecular weight of 596.64 g/mol. Its IUPAC name is [2-[4-(7-hexanoyloxy-4-oxo-3,1-benzoxazin-2-yl)phenyl]-4-oxo-3,1-benzoxazin-7-yl] hexanoate.
| Compound Name | [2-[4-(7-hexanoyloxy-4-oxo-3,1-benzoxazin-2-yl)phenyl]-4-oxo-3,1-benzoxazin-7-yl] hexanoate |
|---|---|
| PubChem CID | 139648468 |
| Molecular Formula | C34H32N2O8 |
| Molecular Weight | 596.64 g/mol |
| Exact Mass | 596.22 |
| IUPAC Name | [2-[4-(7-hexanoyloxy-4-oxo-3,1-benzoxazin-2-yl)phenyl]-4-oxo-3,1-benzoxazin-7-yl] hexanoate |
| SMILES | CCCCCC(=O)Oc1ccc2c(=O)oc(-c3ccc(-c4nc5cc(OC(=O)CCCCC)ccc5c(=O)o4)cc3)nc2c1 |
| InChI | InChI=1S/C34H32N2O8/c1-3-5-7-9-29(37)41-23-15-17-25-27(19-23)35-31(43-33(25)39)21-11-13-22(14-12-21)32-36-28-20-24(16-18-26(28)34(40)44-32)42-30(38)10-8-6-4-2/h11-20H,3-10H2,1-2H3 |
| InChIKey | MCMIQLOXESDYET-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 138.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.64 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|