C18H15N3O4 — CID 20731779
[3-[(2-acetylphenyl)methyl]-4-oxo-1,2,3-benzotriazin-6-yl] acetate (PubChem CID 20731779) has the molecular formula C18H15N3O4 and a molecular weight of 337.34 g/mol. Its IUPAC name is [3-[(2-acetylphenyl)methyl]-4-oxo-1,2,3-benzotriazin-6-yl] acetate.
| Compound Name | [3-[(2-acetylphenyl)methyl]-4-oxo-1,2,3-benzotriazin-6-yl] acetate |
|---|---|
| PubChem CID | 20731779 |
| Molecular Formula | C18H15N3O4 |
| Molecular Weight | 337.34 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | [3-[(2-acetylphenyl)methyl]-4-oxo-1,2,3-benzotriazin-6-yl] acetate |
| SMILES | CC(=O)Oc1ccc2nnn(Cc3ccccc3C(C)=O)c(=O)c2c1 |
| InChI | InChI=1S/C18H15N3O4/c1-11(22)15-6-4-3-5-13(15)10-21-18(24)16-9-14(25-12(2)23)7-8-17(16)19-20-21/h3-9H,10H2,1-2H3 |
| InChIKey | AQYQOFJRPJBAIR-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 91.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.34 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|