About (4-formylphenyl) 2,5-diacetyloxybenzoate
(4-formylphenyl) 2,5-diacetyloxybenzoate (PubChem CID 11624300) has the molecular formula C18H14O7
and a molecular weight of 342.30 g/mol. Its IUPAC name is (4-formylphenyl) 2,5-diacetyloxybenzoate.
Molecular Properties
| Compound Name | (4-formylphenyl) 2,5-diacetyloxybenzoate |
| PubChem CID | 11624300 |
| Molecular Formula | C18H14O7 |
| Molecular Weight | 342.30 g/mol |
| Exact Mass | 342.07 |
| IUPAC Name | (4-formylphenyl) 2,5-diacetyloxybenzoate |
| SMILES | CC(=O)Oc1ccc(OC(C)=O)c(C(=O)Oc2ccc(C=O)cc2)c1 |
| InChI | InChI=1S/C18H14O7/c1-11(20)23-15-7-8-17(24-12(2)21)16(9-15)18(22)25-14-5-3-13(10-19)4-6-14/h3-10H,1-2H3 |
| InChIKey | MIJDYEXDALGHQG-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.30 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-formylphenyl) 2,5-diacetyloxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-formylphenyl) 2,5-diacetyloxybenzoate?
The IUPAC name of (4-formylphenyl) 2,5-diacetyloxybenzoate (CID 11624300) is (4-formylphenyl) 2,5-diacetyloxybenzoate.
What is the SMILES notation for (4-formylphenyl) 2,5-diacetyloxybenzoate?
The canonical SMILES for (4-formylphenyl) 2,5-diacetyloxybenzoate is CC(=O)Oc1ccc(OC(C)=O)c(C(=O)Oc2ccc(C=O)cc2)c1.
What is the InChIKey of (4-formylphenyl) 2,5-diacetyloxybenzoate?
The InChIKey is MIJDYEXDALGHQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14O7/c1-11(20)23-15-7-8-17(24-12(2)21)16(9-15)18(22)25-14-5-3-13(10-19)4-6-14/h3-10H,1-2H3.
What are the key properties of (4-formylphenyl) 2,5-diacetyloxybenzoate?
(4-formylphenyl) 2,5-diacetyloxybenzoate has a molecular weight of 342.30 g/mol, XLogP of 2.57, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (4-formylphenyl) 2,5-diacetyloxybenzoate is sourced from PubChem (CID 11624300), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).