3-(2,5-diacetyloxyphenyl)but-2-enoic acid

C14H14O6 — CID 135121474

IUPAC3-(2,5-diacetyloxyphenyl)but-2-enoic acid
SMILESCC(=O)Oc1ccc(OC(C)=O)c(C(C)=CC(=O)O)c1
InChIInChI=1S/C14H14O6/c1-8(6-14(17)18)12-7-11(19-9(2)15)4-5-13(12)20-10(3)16/h4-7H,1-3H3,(H,17,18)
InChIKeyIYBGJJNJFRGODV-UHFFFAOYSA-N
MW278.26 g/mol
LogP2.03
Rot. Bonds4

About 3-(2,5-diacetyloxyphenyl)but-2-enoic acid

3-(2,5-diacetyloxyphenyl)but-2-enoic acid (PubChem CID 135121474) has the molecular formula C14H14O6 and a molecular weight of 278.26 g/mol. Its IUPAC name is 3-(2,5-diacetyloxyphenyl)but-2-enoic acid.

Molecular Properties

Compound Name3-(2,5-diacetyloxyphenyl)but-2-enoic acid
PubChem CID135121474
Molecular FormulaC14H14O6
Molecular Weight278.26 g/mol
Exact Mass278.08
IUPAC Name3-(2,5-diacetyloxyphenyl)but-2-enoic acid
SMILESCC(=O)Oc1ccc(OC(C)=O)c(C(C)=CC(=O)O)c1
InChIInChI=1S/C14H14O6/c1-8(6-14(17)18)12-7-11(19-9(2)15)4-5-13(12)20-10(3)16/h4-7H,1-3H3,(H,17,18)
InChIKeyIYBGJJNJFRGODV-UHFFFAOYSA-N
XLogP2.03
TPSA89.90 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500278.26
LogP ≤ 52.03
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}

Analyze 3-(2,5-diacetyloxyphenyl)but-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(2,5-diacetyloxyphenyl)but-2-enoic acid?
The IUPAC name of 3-(2,5-diacetyloxyphenyl)but-2-enoic acid (CID 135121474) is 3-(2,5-diacetyloxyphenyl)but-2-enoic acid.
What is the SMILES notation for 3-(2,5-diacetyloxyphenyl)but-2-enoic acid?
The canonical SMILES for 3-(2,5-diacetyloxyphenyl)but-2-enoic acid is CC(=O)Oc1ccc(OC(C)=O)c(C(C)=CC(=O)O)c1.
What is the InChIKey of 3-(2,5-diacetyloxyphenyl)but-2-enoic acid?
The InChIKey is IYBGJJNJFRGODV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14O6/c1-8(6-14(17)18)12-7-11(19-9(2)15)4-5-13(12)20-10(3)16/h4-7H,1-3H3,(H,17,18).
What are the key properties of 3-(2,5-diacetyloxyphenyl)but-2-enoic acid?
3-(2,5-diacetyloxyphenyl)but-2-enoic acid has a molecular weight of 278.26 g/mol, XLogP of 2.03, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,5-diacetyloxyphenyl)but-2-enoic acid is sourced from PubChem (CID 135121474), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).