C13H10N2O5 — CID 137193275
4-hydroxy-5-methyl-2-[2-(4-nitrophenyl)ethenyl]-1,3-oxazin-6-one (PubChem CID 137193275) has the molecular formula C13H10N2O5 and a molecular weight of 274.23 g/mol. Its IUPAC name is 4-hydroxy-5-methyl-2-[2-(4-nitrophenyl)ethenyl]-1,3-oxazin-6-one.
| Compound Name | 4-hydroxy-5-methyl-2-[2-(4-nitrophenyl)ethenyl]-1,3-oxazin-6-one |
|---|---|
| PubChem CID | 137193275 |
| Molecular Formula | C13H10N2O5 |
| Molecular Weight | 274.23 g/mol |
| Exact Mass | 274.06 |
| IUPAC Name | 4-hydroxy-5-methyl-2-[2-(4-nitrophenyl)ethenyl]-1,3-oxazin-6-one |
| SMILES | Cc1c(O)nc(C=Cc2ccc([N+](=O)[O-])cc2)oc1=O |
| InChI | InChI=1S/C13H10N2O5/c1-8-12(16)14-11(20-13(8)17)7-4-9-2-5-10(6-3-9)15(18)19/h2-7,16H,1H3 |
| InChIKey | FVLMRVFWXAVCBG-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 106.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.23 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|