C31H28S4 — CID 145347051
6-tert-butyl-11,19-diethyl-24-methyl-5,12,18,25-tetrathiaheptacyclo[14.10.0.03,14.04,8.09,13.017,21.022,26]hexacosa-1,3,6,8,10,13,15,17(21),19,22(26),23-undecaene (PubChem CID 145347051) has the molecular formula C31H28S4 and a molecular weight of 528.83 g/mol. Its IUPAC name is 6-tert-butyl-11,19-diethyl-24-methyl-5,12,18,25-tetrathiaheptacyclo[14.10.0.03,14.04,8.09,13.017,21.022,26]hexacosa-1,3,6,8,10,13,15,17(21),19,22(26),23-undecaene.
| Compound Name | 6-tert-butyl-11,19-diethyl-24-methyl-5,12,18,25-tetrathiaheptacyclo[14.10.0.03,14.04,8.09,13.017,21.022,26]hexacosa-1,3,6,8,10,13,15,17(21),19,22(26),23-undecaene |
|---|---|
| PubChem CID | 145347051 |
| Molecular Formula | C31H28S4 |
| Molecular Weight | 528.83 g/mol |
| Exact Mass | 528.11 |
| IUPAC Name | 6-tert-butyl-11,19-diethyl-24-methyl-5,12,18,25-tetrathiaheptacyclo[14.10.0.03,14.04,8.09,13.017,21.022,26]hexacosa-1,3,6,8,10,13,15,17(21),19,22(26),23-undecaene |
| SMILES | CCc1cc2c3cc(C)sc3c3cc4c(cc3c2s1)c1sc(CC)cc1c1cc(C(C)(C)C)sc14 |
| InChI | InChI=1S/C31H28S4/c1-7-16-10-19-18-9-15(3)32-27(18)21-12-24-23(13-22(21)28(19)33-16)29-20(11-17(8-2)34-29)25-14-26(31(4,5)6)35-30(24)25/h9-14H,7-8H2,1-6H3 |
| InChIKey | PKMNNBFNLYAMCX-UHFFFAOYSA-N |
| XLogP | 11.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.83 |
| LogP ≤ 5 | 11.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|