C22H26S3 — CID 155761804
4-tert-butyl-9,14-di(propan-2-yl)-3,8,13-trithiatetracyclo[10.3.0.02,6.07,11]pentadeca-1,4,6,9,11,14-hexaene (PubChem CID 155761804) has the molecular formula C22H26S3 and a molecular weight of 386.65 g/mol. Its IUPAC name is 4-tert-butyl-9,14-di(propan-2-yl)-3,8,13-trithiatetracyclo[10.3.0.02,6.07,11]pentadeca-1,4,6,9,11,14-hexaene.
| Compound Name | 4-tert-butyl-9,14-di(propan-2-yl)-3,8,13-trithiatetracyclo[10.3.0.02,6.07,11]pentadeca-1,4,6,9,11,14-hexaene |
|---|---|
| PubChem CID | 155761804 |
| Molecular Formula | C22H26S3 |
| Molecular Weight | 386.65 g/mol |
| Exact Mass | 386.12 |
| IUPAC Name | 4-tert-butyl-9,14-di(propan-2-yl)-3,8,13-trithiatetracyclo[10.3.0.02,6.07,11]pentadeca-1,4,6,9,11,14-hexaene |
| SMILES | CC(C)c1cc2c(s1)c1cc(C(C)C)sc1c1cc(C(C)(C)C)sc21 |
| InChI | InChI=1S/C22H26S3/c1-11(2)16-8-13-19-14(9-17(23-19)12(3)4)21-15(20(13)24-16)10-18(25-21)22(5,6)7/h8-12H,1-7H3 |
| InChIKey | LVQBFFZCVSSYGI-UHFFFAOYSA-N |
| XLogP | 8.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.65 |
| LogP ≤ 5 | 8.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |