C24H34O2S2 — CID 176856993
4,8-dibutoxy-2,6-di(propan-2-yl)thieno[2,3-f][1]benzothiole (PubChem CID 176856993) has the molecular formula C24H34O2S2 and a molecular weight of 418.67 g/mol. Its IUPAC name is 4,8-dibutoxy-2,6-di(propan-2-yl)thieno[2,3-f][1]benzothiole.
| Compound Name | 4,8-dibutoxy-2,6-di(propan-2-yl)thieno[2,3-f][1]benzothiole |
|---|---|
| PubChem CID | 176856993 |
| Molecular Formula | C24H34O2S2 |
| Molecular Weight | 418.67 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | 4,8-dibutoxy-2,6-di(propan-2-yl)thieno[2,3-f][1]benzothiole |
| SMILES | CCCCOc1c2cc(C(C)C)sc2c(OCCCC)c2cc(C(C)C)sc12 |
| InChI | InChI=1S/C24H34O2S2/c1-7-9-11-25-21-17-13-19(15(3)4)28-24(17)22(26-12-10-8-2)18-14-20(16(5)6)27-23(18)21/h13-16H,7-12H2,1-6H3 |
| InChIKey | IEWHLXDPUXMFRV-UHFFFAOYSA-N |
| XLogP | 8.72 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.67 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|