C13H17F3O2 — CID 88539081
2-butoxy-3,4,6-trifluoro-5-propan-2-ylphenol (PubChem CID 88539081) has the molecular formula C13H17F3O2 and a molecular weight of 262.27 g/mol. Its IUPAC name is 2-butoxy-3,4,6-trifluoro-5-propan-2-ylphenol.
| Compound Name | 2-butoxy-3,4,6-trifluoro-5-propan-2-ylphenol |
|---|---|
| PubChem CID | 88539081 |
| Molecular Formula | C13H17F3O2 |
| Molecular Weight | 262.27 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | 2-butoxy-3,4,6-trifluoro-5-propan-2-ylphenol |
| SMILES | CCCCOc1c(O)c(F)c(C(C)C)c(F)c1F |
| InChI | InChI=1S/C13H17F3O2/c1-4-5-6-18-13-11(16)9(14)8(7(2)3)10(15)12(13)17/h7,17H,4-6H2,1-3H3 |
| InChIKey | WJKDCOKNGZBNIS-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.27 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|