C15H26OS — CID 163535841
3-(butoxymethyl)-2,5-di(propan-2-yl)thiophene (PubChem CID 163535841) has the molecular formula C15H26OS and a molecular weight of 254.44 g/mol. Its IUPAC name is 3-(butoxymethyl)-2,5-di(propan-2-yl)thiophene.
| Compound Name | 3-(butoxymethyl)-2,5-di(propan-2-yl)thiophene |
|---|---|
| PubChem CID | 163535841 |
| Molecular Formula | C15H26OS |
| Molecular Weight | 254.44 g/mol |
| Exact Mass | 254.17 |
| IUPAC Name | 3-(butoxymethyl)-2,5-di(propan-2-yl)thiophene |
| SMILES | CCCCOCc1cc(C(C)C)sc1C(C)C |
| InChI | InChI=1S/C15H26OS/c1-6-7-8-16-10-13-9-14(11(2)3)17-15(13)12(4)5/h9,11-12H,6-8,10H2,1-5H3 |
| InChIKey | DWWOXDJZWIYLMT-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.44 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|