C11H13F3O — CID 91719120
5-(butoxymethyl)-1,2,3-trifluorobenzene (PubChem CID 91719120) has the molecular formula C11H13F3O and a molecular weight of 218.22 g/mol. Its IUPAC name is 5-(butoxymethyl)-1,2,3-trifluorobenzene.
| Compound Name | 5-(butoxymethyl)-1,2,3-trifluorobenzene |
|---|---|
| PubChem CID | 91719120 |
| Molecular Formula | C11H13F3O |
| Molecular Weight | 218.22 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | 5-(butoxymethyl)-1,2,3-trifluorobenzene |
| SMILES | CCCCOCc1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C11H13F3O/c1-2-3-4-15-7-8-5-9(12)11(14)10(13)6-8/h5-6H,2-4,7H2,1H3 |
| InChIKey | RQGHHBLIJPHAFF-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.22 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|