C26H17F6NO — CID 175567270
4-[4-[2-[4-(butoxymethyl)-2,6-difluorophenyl]ethynyl]-2-fluorophenyl]-2,3,6-trifluorobenzonitrile (PubChem CID 175567270) has the molecular formula C26H17F6NO and a molecular weight of 473.42 g/mol. Its IUPAC name is 4-[4-[2-[4-(butoxymethyl)-2,6-difluorophenyl]ethynyl]-2-fluorophenyl]-2,3,6-trifluorobenzonitrile.
| Compound Name | 4-[4-[2-[4-(butoxymethyl)-2,6-difluorophenyl]ethynyl]-2-fluorophenyl]-2,3,6-trifluorobenzonitrile |
|---|---|
| PubChem CID | 175567270 |
| Molecular Formula | C26H17F6NO |
| Molecular Weight | 473.42 g/mol |
| Exact Mass | 473.12 |
| IUPAC Name | 4-[4-[2-[4-(butoxymethyl)-2,6-difluorophenyl]ethynyl]-2-fluorophenyl]-2,3,6-trifluorobenzonitrile |
| SMILES | CCCCOCc1cc(F)c(C#Cc2ccc(-c3cc(F)c(C#N)c(F)c3F)c(F)c2)c(F)c1 |
| InChI | InChI=1S/C26H17F6NO/c1-2-3-8-34-14-16-10-22(28)18(23(29)11-16)7-5-15-4-6-17(21(27)9-15)19-12-24(30)20(13-33)26(32)25(19)31/h4,6,9-12H,2-3,8,14H2,1H3 |
| InChIKey | YZWIAPLEXUGZMC-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.42 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|