C12H15F4NO — CID 107644359
N-(2-butoxyethyl)-2,3,5,6-tetrafluoroaniline (PubChem CID 107644359) has the molecular formula C12H15F4NO and a molecular weight of 265.25 g/mol. Its IUPAC name is N-(2-butoxyethyl)-2,3,5,6-tetrafluoroaniline.
| Compound Name | N-(2-butoxyethyl)-2,3,5,6-tetrafluoroaniline |
|---|---|
| PubChem CID | 107644359 |
| Molecular Formula | C12H15F4NO |
| Molecular Weight | 265.25 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | N-(2-butoxyethyl)-2,3,5,6-tetrafluoroaniline |
| SMILES | CCCCOCCNc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C12H15F4NO/c1-2-3-5-18-6-4-17-12-10(15)8(13)7-9(14)11(12)16/h7,17H,2-6H2,1H3 |
| InChIKey | LTYZULPBMQHIMQ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.25 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|