C18H15F9N2O2 — CID 101195346
2,3,4,5,6-pentafluoro-N-[2-[2-[2-(2,3,4,5-tetrafluoroanilino)ethoxy]ethoxy]ethyl]aniline (PubChem CID 101195346) has the molecular formula C18H15F9N2O2 and a molecular weight of 462.31 g/mol. Its IUPAC name is 2,3,4,5,6-pentafluoro-N-[2-[2-[2-(2,3,4,5-tetrafluoroanilino)ethoxy]ethoxy]ethyl]aniline.
| Compound Name | 2,3,4,5,6-pentafluoro-N-[2-[2-[2-(2,3,4,5-tetrafluoroanilino)ethoxy]ethoxy]ethyl]aniline |
|---|---|
| PubChem CID | 101195346 |
| Molecular Formula | C18H15F9N2O2 |
| Molecular Weight | 462.31 g/mol |
| Exact Mass | 462.10 |
| IUPAC Name | 2,3,4,5,6-pentafluoro-N-[2-[2-[2-(2,3,4,5-tetrafluoroanilino)ethoxy]ethoxy]ethyl]aniline |
| SMILES | Fc1cc(NCCOCCOCCNc2c(F)c(F)c(F)c(F)c2F)c(F)c(F)c1F |
| InChI | InChI=1S/C18H15F9N2O2/c19-8-7-9(11(21)12(22)10(8)20)28-1-3-30-5-6-31-4-2-29-18-16(26)14(24)13(23)15(25)17(18)27/h7,28-29H,1-6H2 |
| InChIKey | IHTDNPKIWFJDGA-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.31 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|