C10H12F3NO — CID 62810804
N-(2-ethoxyethyl)-3,4,5-trifluoroaniline (PubChem CID 62810804) has the molecular formula C10H12F3NO and a molecular weight of 219.21 g/mol. Its IUPAC name is N-(2-ethoxyethyl)-3,4,5-trifluoroaniline.
| Compound Name | N-(2-ethoxyethyl)-3,4,5-trifluoroaniline |
|---|---|
| PubChem CID | 62810804 |
| Molecular Formula | C10H12F3NO |
| Molecular Weight | 219.21 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | N-(2-ethoxyethyl)-3,4,5-trifluoroaniline |
| SMILES | CCOCCNc1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C10H12F3NO/c1-2-15-4-3-14-7-5-8(11)10(13)9(12)6-7/h5-6,14H,2-4H2,1H3 |
| InChIKey | XEPRMSXLIFVRCJ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.21 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|