C10H14F2N2O — CID 62532492
2-N-(2-ethoxyethyl)-3,4-difluorobenzene-1,2-diamine (PubChem CID 62532492) has the molecular formula C10H14F2N2O and a molecular weight of 216.23 g/mol. Its IUPAC name is 2-N-(2-ethoxyethyl)-3,4-difluorobenzene-1,2-diamine.
| Compound Name | 2-N-(2-ethoxyethyl)-3,4-difluorobenzene-1,2-diamine |
|---|---|
| PubChem CID | 62532492 |
| Molecular Formula | C10H14F2N2O |
| Molecular Weight | 216.23 g/mol |
| Exact Mass | 216.11 |
| IUPAC Name | 2-N-(2-ethoxyethyl)-3,4-difluorobenzene-1,2-diamine |
| SMILES | CCOCCNc1c(N)ccc(F)c1F |
| InChI | InChI=1S/C10H14F2N2O/c1-2-15-6-5-14-10-8(13)4-3-7(11)9(10)12/h3-4,14H,2,5-6,13H2,1H3 |
| InChIKey | FCHAFZPAFOJSEE-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.23 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|