C11H16F2N2O — CID 65103314
1-(6-amino-2,3-difluoroanilino)-2-methylbutan-2-ol (PubChem CID 65103314) has the molecular formula C11H16F2N2O and a molecular weight of 230.26 g/mol. Its IUPAC name is 1-(6-amino-2,3-difluoroanilino)-2-methylbutan-2-ol.
| Compound Name | 1-(6-amino-2,3-difluoroanilino)-2-methylbutan-2-ol |
|---|---|
| PubChem CID | 65103314 |
| Molecular Formula | C11H16F2N2O |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | 1-(6-amino-2,3-difluoroanilino)-2-methylbutan-2-ol |
| SMILES | CCC(C)(O)CNc1c(N)ccc(F)c1F |
| InChI | InChI=1S/C11H16F2N2O/c1-3-11(2,16)6-15-10-8(14)5-4-7(12)9(10)13/h4-5,15-16H,3,6,14H2,1-2H3 |
| InChIKey | IGFGNSIGVQXXLB-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|