C11H11F2N3S — CID 63242145
3,4-difluoro-2-N-[2-(1,3-thiazol-2-yl)ethyl]benzene-1,2-diamine (PubChem CID 63242145) has the molecular formula C11H11F2N3S and a molecular weight of 255.29 g/mol. Its IUPAC name is 3,4-difluoro-2-N-[2-(1,3-thiazol-2-yl)ethyl]benzene-1,2-diamine.
| Compound Name | 3,4-difluoro-2-N-[2-(1,3-thiazol-2-yl)ethyl]benzene-1,2-diamine |
|---|---|
| PubChem CID | 63242145 |
| Molecular Formula | C11H11F2N3S |
| Molecular Weight | 255.29 g/mol |
| Exact Mass | 255.06 |
| IUPAC Name | 3,4-difluoro-2-N-[2-(1,3-thiazol-2-yl)ethyl]benzene-1,2-diamine |
| SMILES | Nc1ccc(F)c(F)c1NCCc1nccs1 |
| InChI | InChI=1S/C11H11F2N3S/c12-7-1-2-8(14)11(10(7)13)16-4-3-9-15-5-6-17-9/h1-2,5-6,16H,3-4,14H2 |
| InChIKey | MLTHDAXZSKJSJU-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.29 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|