C26H40N2O2S2 — CID 123611737
4,8-bis(2-ethylhexoxy)thieno[2,3-f][1]benzothiole-2,6-diamine (PubChem CID 123611737) has the molecular formula C26H40N2O2S2 and a molecular weight of 476.75 g/mol. Its IUPAC name is 4,8-bis(2-ethylhexoxy)thieno[2,3-f][1]benzothiole-2,6-diamine.
| Compound Name | 4,8-bis(2-ethylhexoxy)thieno[2,3-f][1]benzothiole-2,6-diamine |
|---|---|
| PubChem CID | 123611737 |
| Molecular Formula | C26H40N2O2S2 |
| Molecular Weight | 476.75 g/mol |
| Exact Mass | 476.25 |
| IUPAC Name | 4,8-bis(2-ethylhexoxy)thieno[2,3-f][1]benzothiole-2,6-diamine |
| SMILES | CCCCC(CC)COc1c2cc(N)sc2c(OCC(CC)CCCC)c2cc(N)sc12 |
| InChI | InChI=1S/C26H40N2O2S2/c1-5-9-11-17(7-3)15-29-23-19-13-21(27)32-26(19)24(20-14-22(28)31-25(20)23)30-16-18(8-4)12-10-6-2/h13-14,17-18H,5-12,15-16,27-28H2,1-4H3 |
| InChIKey | YJVYQYNHXKFRKE-UHFFFAOYSA-N |
| XLogP | 8.47 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.75 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |