C26H38O2S2 — CID 86328373
4,8-bis[(2R)-2-ethylhexoxy]thieno[2,3-f][1]benzothiole (PubChem CID 86328373) has the molecular formula C26H38O2S2 and a molecular weight of 446.72 g/mol. Its IUPAC name is 4,8-bis[(2R)-2-ethylhexoxy]thieno[2,3-f][1]benzothiole.
| Compound Name | 4,8-bis[(2R)-2-ethylhexoxy]thieno[2,3-f][1]benzothiole |
|---|---|
| PubChem CID | 86328373 |
| Molecular Formula | C26H38O2S2 |
| Molecular Weight | 446.72 g/mol |
| Exact Mass | 446.23 |
| IUPAC Name | 4,8-bis[(2R)-2-ethylhexoxy]thieno[2,3-f][1]benzothiole |
| SMILES | CCCC[C@@H](CC)COc1c2ccsc2c(OC[C@H](CC)CCCC)c2ccsc12 |
| InChI | InChI=1S/C26H38O2S2/c1-5-9-11-19(7-3)17-27-23-21-13-15-30-26(21)24(22-14-16-29-25(22)23)28-18-20(8-4)12-10-6-2/h13-16,19-20H,5-12,17-18H2,1-4H3/t19-,20-/m1/s1 |
| InChIKey | HATOWNJGYIVNBU-WOJBJXKFSA-N |
| XLogP | 9.31 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.72 |
| LogP ≤ 5 | 9.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |