C30H40O2S3 — CID 132551962
4,8-bis(2-ethylhexoxy)-2-thiophen-2-ylthieno[2,3-f][1]benzothiole (PubChem CID 132551962) has the molecular formula C30H40O2S3 and a molecular weight of 528.85 g/mol. Its IUPAC name is 4,8-bis(2-ethylhexoxy)-2-thiophen-2-ylthieno[2,3-f][1]benzothiole.
| Compound Name | 4,8-bis(2-ethylhexoxy)-2-thiophen-2-ylthieno[2,3-f][1]benzothiole |
|---|---|
| PubChem CID | 132551962 |
| Molecular Formula | C30H40O2S3 |
| Molecular Weight | 528.85 g/mol |
| Exact Mass | 528.22 |
| IUPAC Name | 4,8-bis(2-ethylhexoxy)-2-thiophen-2-ylthieno[2,3-f][1]benzothiole |
| SMILES | CCCCC(CC)COc1c2cc(-c3cccs3)sc2c(OCC(CC)CCCC)c2ccsc12 |
| InChI | InChI=1S/C30H40O2S3/c1-5-9-12-21(7-3)19-31-27-23-15-17-34-29(23)28(32-20-22(8-4)13-10-6-2)24-18-26(35-30(24)27)25-14-11-16-33-25/h11,14-18,21-22H,5-10,12-13,19-20H2,1-4H3 |
| InChIKey | WPGUADIYVMYWPS-UHFFFAOYSA-N |
| XLogP | 11.03 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.85 |
| LogP ≤ 5 | 11.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |