C28H39BrO2S — CID 141422374
2-[2-[6-bromo-2,3-bis(2-ethylhexoxy)phenyl]ethynyl]thiophene (PubChem CID 141422374) has the molecular formula C28H39BrO2S and a molecular weight of 519.59 g/mol. Its IUPAC name is 2-[2-[6-bromo-2,3-bis(2-ethylhexoxy)phenyl]ethynyl]thiophene.
| Compound Name | 2-[2-[6-bromo-2,3-bis(2-ethylhexoxy)phenyl]ethynyl]thiophene |
|---|---|
| PubChem CID | 141422374 |
| Molecular Formula | C28H39BrO2S |
| Molecular Weight | 519.59 g/mol |
| Exact Mass | 518.19 |
| IUPAC Name | 2-[2-[6-bromo-2,3-bis(2-ethylhexoxy)phenyl]ethynyl]thiophene |
| SMILES | CCCCC(CC)COc1ccc(Br)c(C#Cc2cccs2)c1OCC(CC)CCCC |
| InChI | InChI=1S/C28H39BrO2S/c1-5-9-12-22(7-3)20-30-27-18-17-26(29)25(16-15-24-14-11-19-32-24)28(27)31-21-23(8-4)13-10-6-2/h11,14,17-19,22-23H,5-10,12-13,20-21H2,1-4H3 |
| InChIKey | RAXBUZDMWYIOHZ-UHFFFAOYSA-N |
| XLogP | 9.10 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.59 |
| LogP ≤ 5 | 9.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|