C46H86O5 — CID 90923356
1,2,3,4,5-pentakis(2-ethylhexoxy)benzene (PubChem CID 90923356) has the molecular formula C46H86O5 and a molecular weight of 719.19 g/mol. Its IUPAC name is 1,2,3,4,5-pentakis(2-ethylhexoxy)benzene.
| Compound Name | 1,2,3,4,5-pentakis(2-ethylhexoxy)benzene |
|---|---|
| PubChem CID | 90923356 |
| Molecular Formula | C46H86O5 |
| Molecular Weight | 719.19 g/mol |
| Exact Mass | 718.65 |
| IUPAC Name | 1,2,3,4,5-pentakis(2-ethylhexoxy)benzene |
| SMILES | CCCCC(CC)COc1cc(OCC(CC)CCCC)c(OCC(CC)CCCC)c(OCC(CC)CCCC)c1OCC(CC)CCCC |
| InChI | InChI=1S/C46H86O5/c1-11-21-26-37(16-6)32-47-42-31-43(48-33-38(17-7)27-22-12-2)45(50-35-40(19-9)29-24-14-4)46(51-36-41(20-10)30-25-15-5)44(42)49-34-39(18-8)28-23-13-3/h31,37-41H,11-30,32-36H2,1-10H3 |
| InChIKey | VFPKCTPOBJMJMI-UHFFFAOYSA-N |
| XLogP | 14.66 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.19 |
| LogP ≤ 5 | 14.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |