C48H72N2O2S2Se2 — CID 140608746
2-[4,8-bis(2-ethylhexoxy)-2-(4-octyl-1,3-selenazol-2-yl)thieno[2,3-f][1]benzothiol-6-yl]-4-octyl-1,3-selenazole (PubChem CID 140608746) has the molecular formula C48H72N2O2S2Se2 and a molecular weight of 931.17 g/mol. Its IUPAC name is 2-[4,8-bis(2-ethylhexoxy)-2-(4-octyl-1,3-selenazol-2-yl)thieno[2,3-f][1]benzothiol-6-yl]-4-octyl-1,3-selenazole.
| Compound Name | 2-[4,8-bis(2-ethylhexoxy)-2-(4-octyl-1,3-selenazol-2-yl)thieno[2,3-f][1]benzothiol-6-yl]-4-octyl-1,3-selenazole |
|---|---|
| PubChem CID | 140608746 |
| Molecular Formula | C48H72N2O2S2Se2 |
| Molecular Weight | 931.17 g/mol |
| Exact Mass | 932.34 |
| IUPAC Name | 2-[4,8-bis(2-ethylhexoxy)-2-(4-octyl-1,3-selenazol-2-yl)thieno[2,3-f][1]benzothiol-6-yl]-4-octyl-1,3-selenazole |
| SMILES | CCCCCCCCc1c[se]c(-c2cc3c(OCC(CC)CCCC)c4sc(-c5nc(CCCCCCCC)c[se]5)cc4c(OCC(CC)CCCC)c3s2)n1 |
| InChI | InChI=1S/C48H72N2O2S2Se2/c1-7-13-17-19-21-23-27-37-33-55-47(49-37)41-29-39-43(51-31-35(11-5)25-15-9-3)46-40(44(45(39)53-41)52-32-36(12-6)26-16-10-4)30-42(54-46)48-50-38(34-56-48)28-24-22-20-18-14-8-2/h29-30,33-36H,7-28,31-32H2,1-6H3 |
| InChIKey | JMOPOJGYLBCGAP-UHFFFAOYSA-N |
| XLogP | 15.35 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 931.17 |
| LogP ≤ 5 | 15.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|