C28H38O4S2 — CID 122234142
4,8-dioctoxythieno[2,3-f][1]benzothiole-2,6-dicarbaldehyde (PubChem CID 122234142) has the molecular formula C28H38O4S2 and a molecular weight of 502.74 g/mol. Its IUPAC name is 4,8-dioctoxythieno[2,3-f][1]benzothiole-2,6-dicarbaldehyde.
| Compound Name | 4,8-dioctoxythieno[2,3-f][1]benzothiole-2,6-dicarbaldehyde |
|---|---|
| PubChem CID | 122234142 |
| Molecular Formula | C28H38O4S2 |
| Molecular Weight | 502.74 g/mol |
| Exact Mass | 502.22 |
| IUPAC Name | 4,8-dioctoxythieno[2,3-f][1]benzothiole-2,6-dicarbaldehyde |
| SMILES | CCCCCCCCOc1c2cc(C=O)sc2c(OCCCCCCCC)c2cc(C=O)sc12 |
| InChI | InChI=1S/C28H38O4S2/c1-3-5-7-9-11-13-15-31-25-23-17-21(19-29)34-28(23)26(24-18-22(20-30)33-27(24)25)32-16-14-12-10-8-6-4-2/h17-20H,3-16H2,1-2H3 |
| InChIKey | JDPODAXHWNAIOO-UHFFFAOYSA-N |
| XLogP | 9.22 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.74 |
| LogP ≤ 5 | 9.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|