C16H20OS2 — CID 134451270
4,10-ditert-butyl-7-oxa-3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene (PubChem CID 134451270) has the molecular formula C16H20OS2 and a molecular weight of 292.47 g/mol. Its IUPAC name is 4,10-ditert-butyl-7-oxa-3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene.
| Compound Name | 4,10-ditert-butyl-7-oxa-3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene |
|---|---|
| PubChem CID | 134451270 |
| Molecular Formula | C16H20OS2 |
| Molecular Weight | 292.47 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | 4,10-ditert-butyl-7-oxa-3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene |
| SMILES | CC(C)(C)c1cc2oc3cc(C(C)(C)C)sc3c2s1 |
| InChI | InChI=1S/C16H20OS2/c1-15(2,3)11-7-9-13(18-11)14-10(17-9)8-12(19-14)16(4,5)6/h7-8H,1-6H3 |
| InChIKey | ANBKVKISQBYQKW-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.47 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |