C25H24S2Se2 — CID 145347013
2-tert-butyl-4-(5-ethylselenophen-2-yl)-6-methyl-8-selenophen-2-ylthieno[2,3-f][1]benzothiole (PubChem CID 145347013) has the molecular formula C25H24S2Se2 and a molecular weight of 546.52 g/mol. Its IUPAC name is 2-tert-butyl-4-(5-ethylselenophen-2-yl)-6-methyl-8-selenophen-2-ylthieno[2,3-f][1]benzothiole.
| Compound Name | 2-tert-butyl-4-(5-ethylselenophen-2-yl)-6-methyl-8-selenophen-2-ylthieno[2,3-f][1]benzothiole |
|---|---|
| PubChem CID | 145347013 |
| Molecular Formula | C25H24S2Se2 |
| Molecular Weight | 546.52 g/mol |
| Exact Mass | 547.96 |
| IUPAC Name | 2-tert-butyl-4-(5-ethylselenophen-2-yl)-6-methyl-8-selenophen-2-ylthieno[2,3-f][1]benzothiole |
| SMILES | CCc1ccc(-c2c3cc(C(C)(C)C)sc3c(-c3ccc[se]3)c3cc(C)sc23)[se]1 |
| InChI | InChI=1S/C25H24S2Se2/c1-6-15-9-10-19(29-15)22-17-13-20(25(3,4)5)27-24(17)21(18-8-7-11-28-18)16-12-14(2)26-23(16)22/h7-13H,6H2,1-5H3 |
| InChIKey | DTGKHLDYEVJMEA-UHFFFAOYSA-N |
| XLogP | 7.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.52 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|