C8H9NS — CID 142930425
4,5-bis(ethenyl)thiophen-2-amine (PubChem CID 142930425) has the molecular formula C8H9NS and a molecular weight of 151.23 g/mol. Its IUPAC name is 4,5-bis(ethenyl)thiophen-2-amine.
| Compound Name | 4,5-bis(ethenyl)thiophen-2-amine |
|---|---|
| PubChem CID | 142930425 |
| Molecular Formula | C8H9NS |
| Molecular Weight | 151.23 g/mol |
| Exact Mass | 151.05 |
| IUPAC Name | 4,5-bis(ethenyl)thiophen-2-amine |
| SMILES | C=Cc1cc(N)sc1C=C |
| InChI | InChI=1S/C8H9NS/c1-3-6-5-8(9)10-7(6)4-2/h3-5H,1-2,9H2 |
| InChIKey | BJDSSRDMUIHZNR-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.23 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |