C5H6N2S — CID 164761929
4-ethenyl-1,2-thiazol-3-amine (PubChem CID 164761929) has the molecular formula C5H6N2S and a molecular weight of 126.18 g/mol. Its IUPAC name is 4-ethenyl-1,2-thiazol-3-amine.
| Compound Name | 4-ethenyl-1,2-thiazol-3-amine |
|---|---|
| PubChem CID | 164761929 |
| Molecular Formula | C5H6N2S |
| Molecular Weight | 126.18 g/mol |
| Exact Mass | 126.03 |
| IUPAC Name | 4-ethenyl-1,2-thiazol-3-amine |
| SMILES | C=Cc1csnc1N |
| InChI | InChI=1S/C5H6N2S/c1-2-4-3-8-7-5(4)6/h2-3H,1H2,(H2,6,7) |
| InChIKey | YIPWAUAKWAIPLW-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.18 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |