About 3-bromo-4-ethenyl-1,2-thiazole
3-bromo-4-ethenyl-1,2-thiazole (PubChem CID 177317052) has the molecular formula C5H4BrNS
and a molecular weight of 190.06 g/mol. Its IUPAC name is 3-bromo-4-ethenyl-1,2-thiazole.
Molecular Properties
| Compound Name | 3-bromo-4-ethenyl-1,2-thiazole |
| PubChem CID | 177317052 |
| Molecular Formula | C5H4BrNS |
| Molecular Weight | 190.06 g/mol |
| Exact Mass | 188.92 |
| IUPAC Name | 3-bromo-4-ethenyl-1,2-thiazole |
| SMILES | C=Cc1csnc1Br |
| InChI | InChI=1S/C5H4BrNS/c1-2-4-3-8-7-5(4)6/h2-3H,1H2 |
| InChIKey | YPKNTABGQJKVCR-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.06 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-bromo-4-ethenyl-1,2-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-4-ethenyl-1,2-thiazole?
The IUPAC name of 3-bromo-4-ethenyl-1,2-thiazole (CID 177317052) is 3-bromo-4-ethenyl-1,2-thiazole.
What is the SMILES notation for 3-bromo-4-ethenyl-1,2-thiazole?
The canonical SMILES for 3-bromo-4-ethenyl-1,2-thiazole is C=Cc1csnc1Br.
What is the InChIKey of 3-bromo-4-ethenyl-1,2-thiazole?
The InChIKey is YPKNTABGQJKVCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4BrNS/c1-2-4-3-8-7-5(4)6/h2-3H,1H2.
What are the key properties of 3-bromo-4-ethenyl-1,2-thiazole?
3-bromo-4-ethenyl-1,2-thiazole has a molecular weight of 190.06 g/mol, XLogP of 2.55, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-4-ethenyl-1,2-thiazole is sourced from PubChem (CID 177317052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).