C7HBr2F2NS — CID 148590766
4,7-dibromo-5,6-difluoro-2,1-benzothiazole (PubChem CID 148590766) has the molecular formula C7HBr2F2NS and a molecular weight of 328.96 g/mol. Its IUPAC name is 4,7-dibromo-5,6-difluoro-2,1-benzothiazole.
| Compound Name | 4,7-dibromo-5,6-difluoro-2,1-benzothiazole |
|---|---|
| PubChem CID | 148590766 |
| Molecular Formula | C7HBr2F2NS |
| Molecular Weight | 328.96 g/mol |
| Exact Mass | 326.82 |
| IUPAC Name | 4,7-dibromo-5,6-difluoro-2,1-benzothiazole |
| SMILES | Fc1c(F)c(Br)c2nscc2c1Br |
| InChI | InChI=1S/C7HBr2F2NS/c8-3-2-1-13-12-7(2)4(9)6(11)5(3)10/h1H |
| InChIKey | NAOZXEZDKGBUKX-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.96 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|