C6H10BrNS — CID 164527461
3-bromo-4-methyl-1,2-thiazole;ethane (PubChem CID 164527461) has the molecular formula C6H10BrNS and a molecular weight of 208.12 g/mol. Its IUPAC name is 3-bromo-4-methyl-1,2-thiazole;ethane.
| Compound Name | 3-bromo-4-methyl-1,2-thiazole;ethane |
|---|---|
| PubChem CID | 164527461 |
| Molecular Formula | C6H10BrNS |
| Molecular Weight | 208.12 g/mol |
| Exact Mass | 206.97 |
| IUPAC Name | 3-bromo-4-methyl-1,2-thiazole;ethane |
| SMILES | CC.Cc1csnc1Br |
| InChI | InChI=1S/C4H4BrNS.C2H6/c1-3-2-7-6-4(3)5;1-2/h2H,1H3;1-2H3 |
| InChIKey | BISAXQMYRVEHBC-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.12 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |