C9H6N2S2 — CID 12645050
5-methyl-[1,2]thiazolo[3,4-e][2,1]benzothiazole (PubChem CID 12645050) has the molecular formula C9H6N2S2 and a molecular weight of 206.30 g/mol. Its IUPAC name is 5-methyl-[1,2]thiazolo[3,4-e][2,1]benzothiazole.
| Compound Name | 5-methyl-[1,2]thiazolo[3,4-e][2,1]benzothiazole |
|---|---|
| PubChem CID | 12645050 |
| Molecular Formula | C9H6N2S2 |
| Molecular Weight | 206.30 g/mol |
| Exact Mass | 206.00 |
| IUPAC Name | 5-methyl-[1,2]thiazolo[3,4-e][2,1]benzothiazole |
| SMILES | Cc1cc2csnc2c2csnc12 |
| InChI | InChI=1S/C9H6N2S2/c1-5-2-6-3-12-11-9(6)7-4-13-10-8(5)7/h2-4H,1H3 |
| InChIKey | NLFQQVPAEFOOEH-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.30 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |