C12H9NOS — CID 151898033
5-methoxybenzo[g][2,1]benzothiazole (PubChem CID 151898033) has the molecular formula C12H9NOS and a molecular weight of 215.28 g/mol. Its IUPAC name is 5-methoxybenzo[g][2,1]benzothiazole.
| Compound Name | 5-methoxybenzo[g][2,1]benzothiazole |
|---|---|
| PubChem CID | 151898033 |
| Molecular Formula | C12H9NOS |
| Molecular Weight | 215.28 g/mol |
| Exact Mass | 215.04 |
| IUPAC Name | 5-methoxybenzo[g][2,1]benzothiazole |
| SMILES | COc1cc2csnc2c2ccccc12 |
| InChI | InChI=1S/C12H9NOS/c1-14-11-6-8-7-15-13-12(8)10-5-3-2-4-9(10)11/h2-7H,1H3 |
| InChIKey | SSDWGKMYLWIXIC-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.28 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |