C15H16N2O2S — CID 82548972
5-methoxy-N-(2-methoxyethyl)benzo[e][1,3]benzothiazol-2-amine (PubChem CID 82548972) has the molecular formula C15H16N2O2S and a molecular weight of 288.37 g/mol. Its IUPAC name is 5-methoxy-N-(2-methoxyethyl)benzo[e][1,3]benzothiazol-2-amine.
| Compound Name | 5-methoxy-N-(2-methoxyethyl)benzo[e][1,3]benzothiazol-2-amine |
|---|---|
| PubChem CID | 82548972 |
| Molecular Formula | C15H16N2O2S |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | 5-methoxy-N-(2-methoxyethyl)benzo[e][1,3]benzothiazol-2-amine |
| SMILES | COCCNc1nc2c(cc(OC)c3ccccc32)s1 |
| InChI | InChI=1S/C15H16N2O2S/c1-18-8-7-16-15-17-14-11-6-4-3-5-10(11)12(19-2)9-13(14)20-15/h3-6,9H,7-8H2,1-2H3,(H,16,17) |
| InChIKey | DAIZRQBEOJWOFH-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|