C14H18N2O3S — CID 116812467
5-(2,3-dimethoxyphenyl)-N-(2-methoxyethyl)-1,3-thiazol-2-amine (PubChem CID 116812467) has the molecular formula C14H18N2O3S and a molecular weight of 294.38 g/mol. Its IUPAC name is 5-(2,3-dimethoxyphenyl)-N-(2-methoxyethyl)-1,3-thiazol-2-amine.
| Compound Name | 5-(2,3-dimethoxyphenyl)-N-(2-methoxyethyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 116812467 |
| Molecular Formula | C14H18N2O3S |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 5-(2,3-dimethoxyphenyl)-N-(2-methoxyethyl)-1,3-thiazol-2-amine |
| SMILES | COCCNc1ncc(-c2cccc(OC)c2OC)s1 |
| InChI | InChI=1S/C14H18N2O3S/c1-17-8-7-15-14-16-9-12(20-14)10-5-4-6-11(18-2)13(10)19-3/h4-6,9H,7-8H2,1-3H3,(H,15,16) |
| InChIKey | MUETZMFBZATSBU-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 52.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|