C22H26N2O4S — CID 53272089
2-(3,4-dimethoxyphenyl)-N-[[5-(2,3-dimethoxyphenyl)-1,3-thiazol-2-yl]methyl]ethanamine (PubChem CID 53272089) has the molecular formula C22H26N2O4S and a molecular weight of 414.53 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-N-[[5-(2,3-dimethoxyphenyl)-1,3-thiazol-2-yl]methyl]ethanamine.
| Compound Name | 2-(3,4-dimethoxyphenyl)-N-[[5-(2,3-dimethoxyphenyl)-1,3-thiazol-2-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 53272089 |
| Molecular Formula | C22H26N2O4S |
| Molecular Weight | 414.53 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-N-[[5-(2,3-dimethoxyphenyl)-1,3-thiazol-2-yl]methyl]ethanamine |
| SMILES | COc1ccc(CCNCc2ncc(-c3cccc(OC)c3OC)s2)cc1OC |
| InChI | InChI=1S/C22H26N2O4S/c1-25-17-9-8-15(12-19(17)27-3)10-11-23-14-21-24-13-20(29-21)16-6-5-7-18(26-2)22(16)28-4/h5-9,12-13,23H,10-11,14H2,1-4H3 |
| InChIKey | DPAAKVGDAIQHKM-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 61.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.53 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|