C20H21ClN2OS — CID 53272277
2-(3-chlorophenyl)-N-[[5-(2-ethoxyphenyl)-1,3-thiazol-2-yl]methyl]ethanamine (PubChem CID 53272277) has the molecular formula C20H21ClN2OS and a molecular weight of 372.92 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-N-[[5-(2-ethoxyphenyl)-1,3-thiazol-2-yl]methyl]ethanamine.
| Compound Name | 2-(3-chlorophenyl)-N-[[5-(2-ethoxyphenyl)-1,3-thiazol-2-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 53272277 |
| Molecular Formula | C20H21ClN2OS |
| Molecular Weight | 372.92 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | 2-(3-chlorophenyl)-N-[[5-(2-ethoxyphenyl)-1,3-thiazol-2-yl]methyl]ethanamine |
| SMILES | CCOc1ccccc1-c1cnc(CNCCc2cccc(Cl)c2)s1 |
| InChI | InChI=1S/C20H21ClN2OS/c1-2-24-18-9-4-3-8-17(18)19-13-23-20(25-19)14-22-11-10-15-6-5-7-16(21)12-15/h3-9,12-13,22H,2,10-11,14H2,1H3 |
| InChIKey | WGYAMPOBGSOIOZ-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.92 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|