C14H11FN2S — CID 169415942
4-(6-fluoro-4,8-dimethylquinolin-2-yl)-1,2-thiazole (PubChem CID 169415942) has the molecular formula C14H11FN2S and a molecular weight of 258.32 g/mol. Its IUPAC name is 4-(6-fluoro-4,8-dimethylquinolin-2-yl)-1,2-thiazole.
| Compound Name | 4-(6-fluoro-4,8-dimethylquinolin-2-yl)-1,2-thiazole |
|---|---|
| PubChem CID | 169415942 |
| Molecular Formula | C14H11FN2S |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.06 |
| IUPAC Name | 4-(6-fluoro-4,8-dimethylquinolin-2-yl)-1,2-thiazole |
| SMILES | Cc1cc(-c2cnsc2)nc2c(C)cc(F)cc12 |
| InChI | InChI=1S/C14H11FN2S/c1-8-4-13(10-6-16-18-7-10)17-14-9(2)3-11(15)5-12(8)14/h3-7H,1-2H3 |
| InChIKey | LXGCGBRBYQZFLJ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |