C14H14N4S — CID 158407742
ethane;4-(6-isocyano-5-methyl-1H-indazol-3-yl)-1,2-thiazole (PubChem CID 158407742) has the molecular formula C14H14N4S and a molecular weight of 270.36 g/mol. Its IUPAC name is ethane;4-(6-isocyano-5-methyl-1H-indazol-3-yl)-1,2-thiazole.
| Compound Name | ethane;4-(6-isocyano-5-methyl-1H-indazol-3-yl)-1,2-thiazole |
|---|---|
| PubChem CID | 158407742 |
| Molecular Formula | C14H14N4S |
| Molecular Weight | 270.36 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | ethane;4-(6-isocyano-5-methyl-1H-indazol-3-yl)-1,2-thiazole |
| SMILES | CC.[C-]#[N+]c1cc2[nH]nc(-c3cnsc3)c2cc1C |
| InChI | InChI=1S/C12H8N4S.C2H6/c1-7-3-9-11(4-10(7)13-2)15-16-12(9)8-5-14-17-6-8;1-2/h3-6H,1H3,(H,15,16);1-2H3 |
| InChIKey | GYXIVIJERVJFHP-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 45.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.36 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|