C7H6N2S — CID 143569189
7-methyl-[1,2]thiazolo[4,3-b]pyridine (PubChem CID 143569189) has the molecular formula C7H6N2S and a molecular weight of 150.21 g/mol. Its IUPAC name is 7-methyl-[1,2]thiazolo[4,3-b]pyridine.
| Compound Name | 7-methyl-[1,2]thiazolo[4,3-b]pyridine |
|---|---|
| PubChem CID | 143569189 |
| Molecular Formula | C7H6N2S |
| Molecular Weight | 150.21 g/mol |
| Exact Mass | 150.03 |
| IUPAC Name | 7-methyl-[1,2]thiazolo[4,3-b]pyridine |
| SMILES | Cc1ccnc2csnc12 |
| InChI | InChI=1S/C7H6N2S/c1-5-2-3-8-6-4-10-9-7(5)6/h2-4H,1H3 |
| InChIKey | GMOHMWYFUQWLJE-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.21 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |