C11H12N2S2 — CID 164905112
8-methyl-2,3-bis(methylsulfanyl)-1,5-naphthyridine (PubChem CID 164905112) has the molecular formula C11H12N2S2 and a molecular weight of 236.37 g/mol. Its IUPAC name is 8-methyl-2,3-bis(methylsulfanyl)-1,5-naphthyridine.
| Compound Name | 8-methyl-2,3-bis(methylsulfanyl)-1,5-naphthyridine |
|---|---|
| PubChem CID | 164905112 |
| Molecular Formula | C11H12N2S2 |
| Molecular Weight | 236.37 g/mol |
| Exact Mass | 236.04 |
| IUPAC Name | 8-methyl-2,3-bis(methylsulfanyl)-1,5-naphthyridine |
| SMILES | CSc1cc2nccc(C)c2nc1SC |
| InChI | InChI=1S/C11H12N2S2/c1-7-4-5-12-8-6-9(14-2)11(15-3)13-10(7)8/h4-6H,1-3H3 |
| InChIKey | YUMWMQSFAQDUFU-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.37 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |