C9H8N2S — CID 12705267
4-methylsulfanyl-1,5-naphthyridine (PubChem CID 12705267) has the molecular formula C9H8N2S and a molecular weight of 176.24 g/mol. Its IUPAC name is 4-methylsulfanyl-1,5-naphthyridine.
| Compound Name | 4-methylsulfanyl-1,5-naphthyridine |
|---|---|
| PubChem CID | 12705267 |
| Molecular Formula | C9H8N2S |
| Molecular Weight | 176.24 g/mol |
| Exact Mass | 176.04 |
| IUPAC Name | 4-methylsulfanyl-1,5-naphthyridine |
| SMILES | CSc1ccnc2cccnc12 |
| InChI | InChI=1S/C9H8N2S/c1-12-8-4-6-10-7-3-2-5-11-9(7)8/h2-6H,1H3 |
| InChIKey | PKAJRBLPNRIYCP-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.24 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |