C22H30 — CID 143651671
ethane;2,3,6,7-tetramethylanthracene (PubChem CID 143651671) has the molecular formula C22H30 and a molecular weight of 294.48 g/mol. Its IUPAC name is ethane;2,3,6,7-tetramethylanthracene.
| Compound Name | ethane;2,3,6,7-tetramethylanthracene |
|---|---|
| PubChem CID | 143651671 |
| Molecular Formula | C22H30 |
| Molecular Weight | 294.48 g/mol |
| Exact Mass | 294.23 |
| IUPAC Name | ethane;2,3,6,7-tetramethylanthracene |
| SMILES | CC.CC.Cc1cc2cc3cc(C)c(C)cc3cc2cc1C |
| InChI | InChI=1S/C18H18.2C2H6/c1-11-5-15-9-17-7-13(3)14(4)8-18(17)10-16(15)6-12(11)2;2*1-2/h5-10H,1-4H3;2*1-2H3 |
| InChIKey | DZAMJGCDZLFJME-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.48 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|